CAS 1337916-18-3 is the registry number for (6-Bromonaphthalen-2-yl)boronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(6-bromonaphthalen-2-yl)boronic acid (CAS 1337916-18-3) is a chemical compound with the molecular formula C10H8BBrO2 and a molecular weight of 250.89 g/mol. IUPAC name: (6-bromonaphthalen-2-yl)boronic acid. InChIKey: JOSJENCQBZHUDM-UHFFFAOYSA-N.
| Molecular formula | C10H8BBrO2 |
|---|---|
| Molecular weight | 250.89 g/mol |
| IUPAC name | (6-bromonaphthalen-2-yl)boronic acid |
| InChIKey | JOSJENCQBZHUDM-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)Br)(O)O |
Computed by PubChem (NCBI)