CAS 1337962-39-6 appears in our catalog under these names: 5-Bromo-6-chloro-2-methanesulfinylpyrimidin-4-amine, 95%, 5–Bromo–6–chloro–2–methanesulfinylpyrimidin–4–amine, 5-bromo-6-chloro-2-methanesulfinylpyrimidin-4-amine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
5-bromo-6-chloro-2-methylsulfinylpyrimidin-4-amine (CAS 1337962-39-6) is a chemical compound with the molecular formula C5H5BrClN3OS and a molecular weight of 270.54 g/mol. IUPAC name: 5-bromo-6-chloro-2-methylsulfinylpyrimidin-4-amine. InChIKey: OKCBVYPRVWJFRT-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3OS |
|---|---|
| Molecular weight | 270.54 g/mol |
| IUPAC name | 5-bromo-6-chloro-2-methylsulfinylpyrimidin-4-amine |
| InChIKey | OKCBVYPRVWJFRT-UHFFFAOYSA-N |
| SMILES | CS(=O)C1=NC(=C(C(=N1)Cl)Br)N |
Computed by PubChem (NCBI)