CAS 1338090-88-2 is the registry number for 3-(tert-Butyl) 4-ethyl (S)-1,2,3-oxathiazolidine-3,4-dicarboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-tert-butyl 4-O-ethyl (4S)-2,2-dioxooxathiazolidine-3,4-dicarboxylate (CAS 1338090-88-2) is a chemical compound with the molecular formula C10H17NO7S and a molecular weight of 295.31 g/mol. IUPAC name: 3-O-tert-butyl 4-O-ethyl (4S)-2,2-dioxooxathiazolidine-3,4-dicarboxylate. InChIKey: QLOKQAJXFVRWFK-ZETCQYMHSA-N.
| Molecular formula | C10H17NO7S |
|---|---|
| Molecular weight | 295.31 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-ethyl (4S)-2,2-dioxooxathiazolidine-3,4-dicarboxylate |
| InChIKey | QLOKQAJXFVRWFK-ZETCQYMHSA-N |
| SMILES | CCOC(=O)[C@@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)