CAS 1338243-68-7 is the registry number for Benzoic acid, 4-[1-[[(1,1-dimethylethoxy)carbonyl]amino]cyclobutyl]-, methyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]benzoate (CAS 1338243-68-7) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: methyl 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]benzoate. InChIKey: RXNVNVJTEJUGAB-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | methyl 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]benzoate |
| InChIKey | RXNVNVJTEJUGAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)