CAS 1338358-72-7 is the registry number for 3-(Pyrimidin-2-yl)-1H-1,2,4-triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-pyrimidin-2-yl-1H-1,2,4-triazol-3-amine (CAS 1338358-72-7) is a chemical compound with the molecular formula C6H6N6 and a molecular weight of 162.15 g/mol. IUPAC name: 5-pyrimidin-2-yl-1H-1,2,4-triazol-3-amine. InChIKey: SXTZDNIQJOKKNB-UHFFFAOYSA-N.
| Molecular formula | C6H6N6 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-pyrimidin-2-yl-1H-1,2,4-triazol-3-amine |
| InChIKey | SXTZDNIQJOKKNB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=NC(=NN2)N |
Computed by PubChem (NCBI)