CAS 1338494-96-4 is the registry number for 2,2,2-Trichloro-1-(1-ethyl-3,5-dimethyl-1h-pyrazol-4-yl)ethanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,2,2-trichloro-1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol (CAS 1338494-96-4) is a chemical compound with the molecular formula C9H13Cl3N2O and a molecular weight of 271.6 g/mol. IUPAC name: 2,2,2-trichloro-1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol. InChIKey: ZWJYXYXMANYCIF-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl3N2O |
|---|---|
| Molecular weight | 271.6 g/mol |
| IUPAC name | 2,2,2-trichloro-1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol |
| InChIKey | ZWJYXYXMANYCIF-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)C(C(Cl)(Cl)Cl)O)C |
Computed by PubChem (NCBI)