CAS 133868-47-0 is the registry number for (R)–2,3–dihydroxy–2–methylpropyl 4–methylbenzenesulfonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
[(2R)-2,3-dihydroxy-2-methylpropyl] 4-methylbenzenesulfonate (CAS 133868-47-0) is a chemical compound with the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. IUPAC name: [(2R)-2,3-dihydroxy-2-methylpropyl] 4-methylbenzenesulfonate. InChIKey: ZLSNDQILCKGABD-LLVKDONJSA-N.
| Molecular formula | C11H16O5S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | [(2R)-2,3-dihydroxy-2-methylpropyl] 4-methylbenzenesulfonate |
| InChIKey | ZLSNDQILCKGABD-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@](C)(CO)O |
Computed by PubChem (NCBI)