Products 133872-22-7
CAS 133872-22-7 is the registry number for 2′-Amino-spiro[cyclopentane-1,9′-fluorene], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Spiro[cyclopentane-1,9'-fluorene]-2'-amine (CAS 133872-22-7) is a chemical compound with the molecular formula C17H17N and a molecular weight of 235.32 g/mol. IUPAC name: spiro[cyclopentane-1,9'-fluorene]-2'-amine. InChIKey: UTYMFVANFJNNJZ-UHFFFAOYSA-N.
| Molecular formula | C17H17N |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | spiro[cyclopentane-1,9'-fluorene]-2'-amine |
| InChIKey | UTYMFVANFJNNJZ-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C3=CC=CC=C3C4=C2C=C(C=C4)N |
Computed by PubChem (NCBI)