CAS 192699-51-7 is the registry number for 4-(4-tert-Butylphenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(4-tert-butylphenyl)benzonitrile (CAS 192699-51-7) is a chemical compound with the molecular formula C17H17N and a molecular weight of 235.32 g/mol. IUPAC name: 4-(4-tert-butylphenyl)benzonitrile. InChIKey: HHOGBTJTEXAETC-UHFFFAOYSA-N.
| Molecular formula | C17H17N |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)benzonitrile |
| InChIKey | HHOGBTJTEXAETC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)