CAS 133872-23-8 is the registry number for 4-Bromobenzenesulfonyl Chloride-d4. Offered by: TRC. Available pack sizes: 100mg.
4-bromo-2,3,5,6-tetradeuteriobenzenesulfonyl chloride (CAS 133872-23-8) is a chemical compound with the molecular formula C6H4BrClO2S and a molecular weight of 259.54 g/mol. IUPAC name: 4-bromo-2,3,5,6-tetradeuteriobenzenesulfonyl chloride. InChIKey: KMMHZIBWCXYAAH-RHQRLBAQSA-N.
| Molecular formula | C6H4BrClO2S |
|---|---|
| Molecular weight | 259.54 g/mol |
| IUPAC name | 4-bromo-2,3,5,6-tetradeuteriobenzenesulfonyl chloride |
| InChIKey | KMMHZIBWCXYAAH-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1S(=O)(=O)Cl)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)