CAS 1338793-07-9 is the registry number for CFI-400936. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(dimethylamino)-2-(2-ethylphenyl)-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]acetamide (CAS 1338793-07-9) is a chemical compound with the molecular formula C25H27N5O3S and a molecular weight of 477.6 g/mol. IUPAC name: 2-(dimethylamino)-2-(2-ethylphenyl)-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]acetamide. InChIKey: JAHXQCZCZURPTI-UHFFFAOYSA-N.
| Molecular formula | C25H27N5O3S |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | 2-(dimethylamino)-2-(2-ethylphenyl)-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]acetamide |
| InChIKey | JAHXQCZCZURPTI-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC=C1C(C(=O)NC2=CC3=C(C=C2)NN=C3C4=CC(=CC=C4)S(=O)(=O)N)N(C)C |
Computed by PubChem (NCBI)