CAS 1338830-37-7 appears in our catalog under these names: Telmisartan EP Impurity B Methyl Ester, Telmisartan Impurity 24, 4'-((1,7'-Dimethyl-2'-propyl(2,5'-bi-1H-benzimidazol)-1'-yl)methyl)(1,1'-biphenyl)-2-carboxylic Acid Methyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (CAS 1338830-37-7) is a chemical compound with the molecular formula C34H32N4O2 and a molecular weight of 528.6 g/mol. IUPAC name: methyl 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate. InChIKey: LQYLOUKANBPDCQ-UHFFFAOYSA-N.
| Molecular formula | C34H32N4O2 |
|---|---|
| Molecular weight | 528.6 g/mol |
| IUPAC name | methyl 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| InChIKey | LQYLOUKANBPDCQ-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)OC)C(=CC(=C2)C5=NC6=CC=CC=C6N5C)C |
Computed by PubChem (NCBI)