Products 13389-10-1
CAS 13389-10-1 is the registry number for 2'-Deoxy-8-methylamino-adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,5R)-5-[6-amino-8-(methylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 13389-10-1) is a chemical compound with the molecular formula C11H16N6O3 and a molecular weight of 280.28 g/mol. IUPAC name: (2R,3S,5R)-5-[6-amino-8-(methylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: QPKHFQHVYJMSQB-RRKCRQDMSA-N.
| Molecular formula | C11H16N6O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R,3S,5R)-5-[6-amino-8-(methylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | QPKHFQHVYJMSQB-RRKCRQDMSA-N |
| SMILES | CNC1=NC2=C(N=CN=C2N1[C@H]3C[C@@H]([C@H](O3)CO)O)N |
Computed by PubChem (NCBI)