CAS 1338954-37-2 is the registry number for 1-(Chloromethyl)-2-(3,3,3-trifluoropropoxy)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(chloromethyl)-2-(3,3,3-trifluoropropoxy)benzene (CAS 1338954-37-2) is a chemical compound with the molecular formula C10H10ClF3O and a molecular weight of 238.63 g/mol. IUPAC name: 1-(chloromethyl)-2-(3,3,3-trifluoropropoxy)benzene. InChIKey: KJNQFOCOBPATRO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3O |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 1-(chloromethyl)-2-(3,3,3-trifluoropropoxy)benzene |
| InChIKey | KJNQFOCOBPATRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)OCCC(F)(F)F |
Computed by PubChem (NCBI)