Products 1338971-47-3

CAS 1338971-47-3 is the registry number for 1-Hydroxy-4,4-dimethylcyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-hydroxy-4,4-dimethylcyclohexane-1-carboxylic acid (CAS 1338971-47-3) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: 1-hydroxy-4,4-dimethylcyclohexane-1-carboxylic acid. InChIKey: PNWWJRHQVQFHQN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O3
Molecular weight172.22 g/mol
IUPAC name1-hydroxy-4,4-dimethylcyclohexane-1-carboxylic acid
InChIKeyPNWWJRHQVQFHQN-UHFFFAOYSA-N
SMILESCC1(CCC(CC1)(C(=O)O)O)C

Computed by PubChem (NCBI)