CAS 1339024-98-4 is the registry number for 4-(Methylsulfonyl)piperazine-1-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 10g, 1g, 5g.
4-methylsulfonylpiperazine-1-sulfonyl chloride (CAS 1339024-98-4) is a chemical compound with the molecular formula C5H11ClN2O4S2 and a molecular weight of 262.7 g/mol. IUPAC name: 4-methylsulfonylpiperazine-1-sulfonyl chloride. InChIKey: GRBIWZOPWQAQCY-UHFFFAOYSA-N.
| Molecular formula | C5H11ClN2O4S2 |
|---|---|
| Molecular weight | 262.7 g/mol |
| IUPAC name | 4-methylsulfonylpiperazine-1-sulfonyl chloride |
| InChIKey | GRBIWZOPWQAQCY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)