CAS 1339116-07-2 is the registry number for (6,6-Dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methanamine (CAS 1339116-07-2) is a chemical compound with the molecular formula C10H16N2S and a molecular weight of 196.31 g/mol. IUPAC name: (6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methanamine. InChIKey: DUOZXXLFTUAWAL-UHFFFAOYSA-N.
| Molecular formula | C10H16N2S |
|---|---|
| Molecular weight | 196.31 g/mol |
| IUPAC name | (6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazol-2-yl)methanamine |
| InChIKey | DUOZXXLFTUAWAL-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)SC(=N2)CN)C |
Computed by PubChem (NCBI)