CAS 1339140-89-4 appears in our catalog under these names: 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride, 95%, 1-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-methyl-2,4-dioxopyrimidine-5-sulfonyl chloride (CAS 1339140-89-4) is a chemical compound with the molecular formula C5H5ClN2O4S and a molecular weight of 224.62 g/mol. IUPAC name: 1-methyl-2,4-dioxopyrimidine-5-sulfonyl chloride. InChIKey: DITGBQGSWHCHRM-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O4S |
|---|---|
| Molecular weight | 224.62 g/mol |
| IUPAC name | 1-methyl-2,4-dioxopyrimidine-5-sulfonyl chloride |
| InChIKey | DITGBQGSWHCHRM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)NC1=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)