CAS 1339143-15-5 is the registry number for 3-Chloro-α-cyclohexyl-4-fluorobenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-chloro-4-fluorophenyl)-cyclohexylmethanol (CAS 1339143-15-5) is a chemical compound with the molecular formula C13H16ClFO and a molecular weight of 242.71 g/mol. IUPAC name: (3-chloro-4-fluorophenyl)-cyclohexylmethanol. InChIKey: ARVWPBDVVDBZKO-UHFFFAOYSA-N.
| Molecular formula | C13H16ClFO |
|---|---|
| Molecular weight | 242.71 g/mol |
| IUPAC name | (3-chloro-4-fluorophenyl)-cyclohexylmethanol |
| InChIKey | ARVWPBDVVDBZKO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC(=C(C=C2)F)Cl)O |
Computed by PubChem (NCBI)