CAS 1339223-64-1 is the registry number for 5-(Quinoxalin-6-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-quinoxalin-6-yl-1,3,4-thiadiazol-2-amine (CAS 1339223-64-1) is a chemical compound with the molecular formula C10H7N5S and a molecular weight of 229.26 g/mol. IUPAC name: 5-quinoxalin-6-yl-1,3,4-thiadiazol-2-amine. InChIKey: KXBUYMUMWUQKDG-UHFFFAOYSA-N.
| Molecular formula | C10H7N5S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 5-quinoxalin-6-yl-1,3,4-thiadiazol-2-amine |
| InChIKey | KXBUYMUMWUQKDG-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C=C1C3=NN=C(S3)N |
Computed by PubChem (NCBI)