CAS 1339330-52-7 appears in our catalog under these names: 4-Iodo-1-(2-phenylethyl)-1h-pyrazole, 95%, 4–IODO–1–(2–PHENYLETHYL)–1H–PYRAZOLE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
4-iodo-1-(2-phenylethyl)pyrazole (CAS 1339330-52-7) is a chemical compound with the molecular formula C11H11IN2 and a molecular weight of 298.12 g/mol. IUPAC name: 4-iodo-1-(2-phenylethyl)pyrazole. InChIKey: FEOGEGPMUHGXER-UHFFFAOYSA-N.
| Molecular formula | C11H11IN2 |
|---|---|
| Molecular weight | 298.12 g/mol |
| IUPAC name | 4-iodo-1-(2-phenylethyl)pyrazole |
| InChIKey | FEOGEGPMUHGXER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C=C(C=N2)I |
Computed by PubChem (NCBI)