CAS 133953-35-2 appears in our catalog under these names: 2,4-Dibromodibenzo(b,d)furan-3-amine, 95-<97%, 2,4-Dibromodibenzo[b,d]furan-3-amine, 97%, 97%, 2,4-Dibromodibenzo[b,d]furan-3-amine, 97%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 100mg, 250mg.
2,4-dibromodibenzofuran-3-amine (CAS 133953-35-2) is a chemical compound with the molecular formula C12H7Br2NO and a molecular weight of 341.00 g/mol. IUPAC name: 2,4-dibromodibenzofuran-3-amine. InChIKey: DMFNPDSYVLWUSV-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2NO |
|---|---|
| Molecular weight | 341.00 g/mol |
| IUPAC name | 2,4-dibromodibenzofuran-3-amine |
| InChIKey | DMFNPDSYVLWUSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=C(C(=C3O2)Br)N)Br |
Computed by PubChem (NCBI)