CAS 133970-31-7 appears in our catalog under these names: Fmoc–Lys(2–Cl–Z)–OH, Fmoc-L-Lys(2-Cl-Z)-OH, Fmoc-Lys(2-Cl-Cbz)-OH 98%, Fmoc-Lys(2-Cl-Z)-OH, 98%, 98%, Fmoc-Lys(2-Cl-Z)-OH, 99.34%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 5g, 100g, 1g, 25 g, 10 g, 5 g.
(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 133970-31-7) is a chemical compound with the molecular formula C29H29ClN2O6 and a molecular weight of 537.0 g/mol. IUPAC name: (2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: VUEYAXRHPZGZOL-SANMLTNESA-N.
| Molecular formula | C29H29ClN2O6 |
|---|---|
| Molecular weight | 537.0 g/mol |
| IUPAC name | (2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | VUEYAXRHPZGZOL-SANMLTNESA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)