CAS 1339764-21-4 is the registry number for 2-(3-Cyclopropyl-1H-pyrazol-1-yl)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-cyclopropylpyrazol-1-yl)-3-methylbutanoic acid (CAS 1339764-21-4) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-(3-cyclopropylpyrazol-1-yl)-3-methylbutanoic acid. InChIKey: BDLIEDNHRZSELH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-(3-cyclopropylpyrazol-1-yl)-3-methylbutanoic acid |
| InChIKey | BDLIEDNHRZSELH-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1C=CC(=N1)C2CC2 |
Computed by PubChem (NCBI)