CAS 133992-79-7 appears in our catalog under these names: 3-Phenyl-2-(4,4,4-trifluoro-3-oxo-but-1-enylamino)-propionic acid, 95%, 3-Phenyl-2-((4,4,4-trifluoro-3-oxobut-1-en-1-yl)amino)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanoic acid (CAS 133992-79-7) is a chemical compound with the molecular formula C13H12F3NO3 and a molecular weight of 287.23 g/mol. IUPAC name: 3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanoic acid. InChIKey: MLIIENMBDGAIEZ-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO3 |
|---|---|
| Molecular weight | 287.23 g/mol |
| IUPAC name | 3-phenyl-2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]propanoic acid |
| InChIKey | MLIIENMBDGAIEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC=CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)