CAS 134-05-4 appears in our catalog under these names: N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid, 98%, 98%, Formylfolic acid, 95%, Folinic Acid EP Impurity D, 10-Formyl Folic Acid, 10-Formylfolic acid/ 98.42% (existing batch purity). Offered by: Chemat, Combi-blocks, Chemat Brand, TRC, TargetMol. Available pack sizes: 100mg, 250mg, 1g, on request, 50mg, 1mg, 5mg, 10mg.
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid (CAS 134-05-4) is a chemical compound with the molecular formula C20H19N7O7 and a molecular weight of 469.4 g/mol. IUPAC name: (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid. InChIKey: UGWUWNVTCLDEOG-ZDUSSCGKSA-N.
| Molecular formula | C20H19N7O7 |
|---|---|
| Molecular weight | 469.4 g/mol |
| IUPAC name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | UGWUWNVTCLDEOG-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)C=O |
Computed by PubChem (NCBI)