Products 1340100-87-9

CAS 1340100-87-9 is the registry number for 3-Ethoxy-2-methylpropane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-ethoxy-2-methylpropane-1-sulfonyl chloride (CAS 1340100-87-9) is a chemical compound with the molecular formula C6H13ClO3S and a molecular weight of 200.68 g/mol. IUPAC name: 3-ethoxy-2-methylpropane-1-sulfonyl chloride. InChIKey: PJWJFFVARYEUPD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClO3S
Molecular weight200.68 g/mol
IUPAC name3-ethoxy-2-methylpropane-1-sulfonyl chloride
InChIKeyPJWJFFVARYEUPD-UHFFFAOYSA-N
SMILESCCOCC(C)CS(=O)(=O)Cl

Computed by PubChem (NCBI)