CAS 1340429-43-7 appears in our catalog under these names: 3-Bromo-1-(3,4-dichlorophenyl)piperidin-2-one, 95%, 3-Bromo-1-(3,4-dichlorophenyl)piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-bromo-1-(3,4-dichlorophenyl)piperidin-2-one (CAS 1340429-43-7) is a chemical compound with the molecular formula C11H10BrCl2NO and a molecular weight of 323.01 g/mol. IUPAC name: 3-bromo-1-(3,4-dichlorophenyl)piperidin-2-one. InChIKey: UJGKWAZDRNQXCN-UHFFFAOYSA-N.
| Molecular formula | C11H10BrCl2NO |
|---|---|
| Molecular weight | 323.01 g/mol |
| IUPAC name | 3-bromo-1-(3,4-dichlorophenyl)piperidin-2-one |
| InChIKey | UJGKWAZDRNQXCN-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC(=C(C=C2)Cl)Cl)Br |
Computed by PubChem (NCBI)