CAS 1340512-06-2 is the registry number for 1-(3,5-Difluorophenyl)cyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-difluorophenyl)cyclohexan-1-ol (CAS 1340512-06-2) is a chemical compound with the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. IUPAC name: 1-(3,5-difluorophenyl)cyclohexan-1-ol. InChIKey: WRLFIHJXZDPITP-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)cyclohexan-1-ol |
| InChIKey | WRLFIHJXZDPITP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC(=C2)F)F)O |
Computed by PubChem (NCBI)