CAS 1340545-88-1 appears in our catalog under these names: (3,5-Dimethyladamantan-1-yl)glycine, 98%, Memantine Glycine, Memantine Glycine, >95% (HPLC), Memantine-Glycine Adduct HCl. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
2-[(3,5-dimethyl-1-adamantyl)amino]acetic acid (CAS 1340545-88-1) is a chemical compound with the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. IUPAC name: 2-[(3,5-dimethyl-1-adamantyl)amino]acetic acid. InChIKey: VENQYZMKCWDVAQ-UHFFFAOYSA-N.
| Molecular formula | C14H23NO2 |
|---|---|
| Molecular weight | 237.34 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-1-adamantyl)amino]acetic acid |
| InChIKey | VENQYZMKCWDVAQ-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)NCC(=O)O)C |
Computed by PubChem (NCBI)