CAS 1340734-73-7 is the registry number for 1-(2-Fluoro-5-methylphenyl)-5-(pyridin-3-yl)-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2-fluoro-5-methylphenyl)-5-pyridin-3-yltriazole-4-carboxylic acid (CAS 1340734-73-7) is a chemical compound with the molecular formula C15H11FN4O2 and a molecular weight of 298.27 g/mol. IUPAC name: 1-(2-fluoro-5-methylphenyl)-5-pyridin-3-yltriazole-4-carboxylic acid. InChIKey: ABEGPQWZVWXYAD-UHFFFAOYSA-N.
| Molecular formula | C15H11FN4O2 |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | 1-(2-fluoro-5-methylphenyl)-5-pyridin-3-yltriazole-4-carboxylic acid |
| InChIKey | ABEGPQWZVWXYAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)F)N2C(=C(N=N2)C(=O)O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)