CAS 1341007-95-1 is the registry number for E234G HYPE-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(furan-3-yl)-5-(6-imidazol-1-yl-3-pyridinyl)-1,3,4-oxadiazole (CAS 1341007-95-1) is a chemical compound with the molecular formula C14H9N5O2 and a molecular weight of 279.25 g/mol. IUPAC name: 2-(furan-3-yl)-5-(6-imidazol-1-yl-3-pyridinyl)-1,3,4-oxadiazole. InChIKey: ODJVBWZFCWFPCB-UHFFFAOYSA-N.
| Molecular formula | C14H9N5O2 |
|---|---|
| Molecular weight | 279.25 g/mol |
| IUPAC name | 2-(furan-3-yl)-5-(6-imidazol-1-yl-3-pyridinyl)-1,3,4-oxadiazole |
| InChIKey | ODJVBWZFCWFPCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=NN=C(O2)C3=COC=C3)N4C=CN=C4 |
Computed by PubChem (NCBI)