CAS 1341030-00-9 appears in our catalog under these names: MTDH–SND1 blocker 1, MTDH-SND1 blocker 1, 99.33%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 10 mg, 5 mg, 10mM/1mL, 100 mg.
5-chloro-2-methoxy-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide (CAS 1341030-00-9) is a chemical compound with the molecular formula C14H13ClN4O3S and a molecular weight of 352.8 g/mol. IUPAC name: 5-chloro-2-methoxy-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide. InChIKey: HLRMNXITZQAUIH-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4O3S |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 5-chloro-2-methoxy-N-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)benzenesulfonamide |
| InChIKey | HLRMNXITZQAUIH-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=CC=C(C2=N1)NS(=O)(=O)C3=C(C=CC(=C3)Cl)OC |
Computed by PubChem (NCBI)