CAS 1341039-99-3 is the registry number for Benzyl 3-chloro-4-cyano-6,7-dihydro-5h-pyrido[3,4-c]azepine-8(9h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Benzyl 3-chloro-4-cyano-5,6,7,9-tetrahydropyrido[3,4-c]azepine-8-carboxylate (CAS 1341039-99-3) is a chemical compound with the molecular formula C18H16ClN3O2 and a molecular weight of 341.8 g/mol. IUPAC name: benzyl 3-chloro-4-cyano-5,6,7,9-tetrahydropyrido[3,4-c]azepine-8-carboxylate. InChIKey: ZKVDSPUYSDDKRW-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O2 |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | benzyl 3-chloro-4-cyano-5,6,7,9-tetrahydropyrido[3,4-c]azepine-8-carboxylate |
| InChIKey | ZKVDSPUYSDDKRW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NC=C2CN(C1)C(=O)OCC3=CC=CC=C3)Cl)C#N |
Computed by PubChem (NCBI)