Products 1341040-41-2
CAS 1341040-41-2 is the registry number for 6′-Chloro-2,3,5,6-tetrahydrospiro[4H-pyran-4,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
6-chlorospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-oxane]-2-one (CAS 1341040-41-2) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 6-chlorospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-oxane]-2-one. InChIKey: FRLPFFZHKMYGBZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 6-chlorospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-oxane]-2-one |
| InChIKey | FRLPFFZHKMYGBZ-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(NC2=O)N=C(C=C3)Cl |
Computed by PubChem (NCBI)