CAS 134130-20-4 is the registry number for 9,9-Bis(4-trifluorovinyloxyphenyl)fluorene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene (CAS 134130-20-4) is a chemical compound with the molecular formula C29H16F6O2 and a molecular weight of 510.4 g/mol. IUPAC name: 9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene. InChIKey: WXKOBYPPBQWLOO-UHFFFAOYSA-N.
| Molecular formula | C29H16F6O2 |
|---|---|
| Molecular weight | 510.4 g/mol |
| IUPAC name | 9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluorene |
| InChIKey | WXKOBYPPBQWLOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(C4=CC=C(C=C4)OC(=C(F)F)F)C5=CC=C(C=C5)OC(=C(F)F)F |
Computed by PubChem (NCBI)