CAS 1341518-87-3 appears in our catalog under these names: 2,2,2-Trifluoro-1-(pyrazin-2-yl)ethanol, 95%, 2,2,2-Trifluoro-1-(pyrazin-2-yl)ethanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2,2-trifluoro-1-pyrazin-2-ylethanol (CAS 1341518-87-3) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-pyrazin-2-ylethanol. InChIKey: XPQOAMXGEIAXRT-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-pyrazin-2-ylethanol |
| InChIKey | XPQOAMXGEIAXRT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)