CAS 1341584-96-0 is the registry number for α-Cyclopropyl-2,3-difluorobenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(2,3-difluorophenyl)methanol (CAS 1341584-96-0) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: cyclopropyl-(2,3-difluorophenyl)methanol. InChIKey: YBQPQMIWUJVVKA-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | cyclopropyl-(2,3-difluorophenyl)methanol |
| InChIKey | YBQPQMIWUJVVKA-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C(=CC=C2)F)F)O |
Computed by PubChem (NCBI)