CAS 1341670-43-6 is the registry number for 3-tert-Butyl-6-fluoro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-tert-butyl-6-fluoro-1,2,3,4-tetrahydroquinoline (CAS 1341670-43-6) is a chemical compound with the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. IUPAC name: 3-tert-butyl-6-fluoro-1,2,3,4-tetrahydroquinoline. InChIKey: SNSGMWWCKRQFEQ-UHFFFAOYSA-N.
| Molecular formula | C13H18FN |
|---|---|
| Molecular weight | 207.29 g/mol |
| IUPAC name | 3-tert-butyl-6-fluoro-1,2,3,4-tetrahydroquinoline |
| InChIKey | SNSGMWWCKRQFEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC2=C(C=CC(=C2)F)NC1 |
Computed by PubChem (NCBI)