CAS 134178-04-4 appears in our catalog under these names: 5-(Chlorosulfonyl)benzene-1,3-dicarboxylic acid, 95%, 5-(Chlorosulfonyl)benzene-1,3-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-chlorosulfonylbenzene-1,3-dicarboxylic acid (CAS 134178-04-4) is a chemical compound with the molecular formula C8H5ClO6S and a molecular weight of 264.64 g/mol. IUPAC name: 5-chlorosulfonylbenzene-1,3-dicarboxylic acid. InChIKey: HPZPALJUGOSUMI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO6S |
|---|---|
| Molecular weight | 264.64 g/mol |
| IUPAC name | 5-chlorosulfonylbenzene-1,3-dicarboxylic acid |
| InChIKey | HPZPALJUGOSUMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)