CAS 1342211-31-7 appears in our catalog under these names: MC–Val–Ala–OH, MC-Val-Ala-OH 98%, (S)-2-((S)-2-(6-(2,5-Dioxo-2H-pyrrol-1(5H)-yl)hexanamido)-3-methylbutanamido)propanoic acid, 98%, 98%, MC-Val-Ala-OH, 99.80%, MC-Val-Ala-OH, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 50mg, 1 g, 25 mg, 50 mg.
(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoic acid (CAS 1342211-31-7) is a chemical compound with the molecular formula C18H27N3O6 and a molecular weight of 381.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoic acid. InChIKey: GSWKJIWKGSPISH-LRDDRELGSA-N.
| Molecular formula | C18H27N3O6 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoic acid |
| InChIKey | GSWKJIWKGSPISH-LRDDRELGSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)CCCCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)