Products 134234-13-2

CAS 134234-13-2 is the registry number for (R,R)-Traxoprodil, 99.00%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg.

Structural formula: {0} (CAS {1})

1-[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol (CAS 134234-13-2) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 327.4 g/mol. IUPAC name: 1-[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol. InChIKey: QEMSVZNTSXPFJA-BEFAXECRSA-N.

Identity
Molecular formulaC20H25NO3
Molecular weight327.4 g/mol
IUPAC name1-[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol
InChIKeyQEMSVZNTSXPFJA-BEFAXECRSA-N
SMILESC[C@H]([C@@H](C1=CC=C(C=C1)O)O)N2CCC(CC2)(C3=CC=CC=C3)O

Computed by PubChem (NCBI)