CAS 134234-13-2 is the registry number for (R,R)-Traxoprodil, 99.00%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg.
1-[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol (CAS 134234-13-2) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 327.4 g/mol. IUPAC name: 1-[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol. InChIKey: QEMSVZNTSXPFJA-BEFAXECRSA-N.
| Molecular formula | C20H25NO3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 1-[(1R,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol |
| InChIKey | QEMSVZNTSXPFJA-BEFAXECRSA-N |
| SMILES | C[C@H]([C@@H](C1=CC=C(C=C1)O)O)N2CCC(CC2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)