Products 134235-13-5
CAS 134235-13-5 is the registry number for Mannostatin A hydrochloride. Offered by: Biosynth. Available pack sizes: 5mg, 1mg.
(1R,2R,3R,4S,5S)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol (CAS 134235-13-5) is a chemical compound with the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. IUPAC name: (1R,2R,3R,4S,5S)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol. InChIKey: BLOFGONIVNXZME-BSQWINAVSA-N.
| Molecular formula | C6H13NO3S |
|---|---|
| Molecular weight | 179.24 g/mol |
| IUPAC name | (1R,2R,3R,4S,5S)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol |
| InChIKey | BLOFGONIVNXZME-BSQWINAVSA-N |
| SMILES | CS[C@H]1[C@H]([C@H]([C@H]([C@H]1O)O)O)N |
Computed by PubChem (NCBI)