Products 1342385-03-8
CAS 1342385-03-8 appears in our catalog under these names: tert-Butyl 6-oxo-1,6-dihydropyridine-3-carboxylate, 95%, 6-Hydroxy-nicotinic acid tert-butyl ester, 95%, tert-Butyl 6-hydroxynicotinate, 97%, tert-Butyl 6-oxo-1,6-dihydropyridine-3-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
Tert-butyl 6-oxo-1H-pyridine-3-carboxylate (CAS 1342385-03-8) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: tert-butyl 6-oxo-1H-pyridine-3-carboxylate. InChIKey: ZQMWSXMQDAFZSO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | tert-butyl 6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | ZQMWSXMQDAFZSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CNC(=O)C=C1 |
Computed by PubChem (NCBI)