Products 1342395-00-9

CAS 1342395-00-9 is the registry number for 1-Amino-3,3-dimethylcyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-amino-3,3-dimethylcyclohexane-1-carboxylic acid (CAS 1342395-00-9) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: 1-amino-3,3-dimethylcyclohexane-1-carboxylic acid. InChIKey: NNLUUBZIUUDZLR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2
Molecular weight171.24 g/mol
IUPAC name1-amino-3,3-dimethylcyclohexane-1-carboxylic acid
InChIKeyNNLUUBZIUUDZLR-UHFFFAOYSA-N
SMILESCC1(CCCC(C1)(C(=O)O)N)C

Computed by PubChem (NCBI)