CAS 1342662-40-1 is the registry number for 2-(3,4,5-Trifluorophenyl)-1H-imidazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4,5-trifluorophenyl)-1H-imidazole-5-carbaldehyde (CAS 1342662-40-1) is a chemical compound with the molecular formula C10H5F3N2O and a molecular weight of 226.15 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)-1H-imidazole-5-carbaldehyde. InChIKey: FZDCAHCVDHIZNR-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N2O |
|---|---|
| Molecular weight | 226.15 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)-1H-imidazole-5-carbaldehyde |
| InChIKey | FZDCAHCVDHIZNR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C2=NC=C(N2)C=O |
Computed by PubChem (NCBI)