Products 1342722-00-2
CAS 1342722-00-2 is the registry number for 2-(Ethylthio)-5-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-ethylsulfanyl-5-(trifluoromethyl)benzoic acid (CAS 1342722-00-2) is a chemical compound with the molecular formula C10H9F3O2S and a molecular weight of 250.24 g/mol. IUPAC name: 2-ethylsulfanyl-5-(trifluoromethyl)benzoic acid. InChIKey: DPGVRVYVPKNMKH-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2S |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | 2-ethylsulfanyl-5-(trifluoromethyl)benzoic acid |
| InChIKey | DPGVRVYVPKNMKH-UHFFFAOYSA-N |
| SMILES | CCSC1=C(C=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)