Products 1342722-90-0

CAS 1342722-90-0 is the registry number for N-(1-Methyl-1H-pyrazol-4-yl)acetamide. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1000mg, 500mg, 2000mg, 5000mg.

Structural formula: {0} (CAS {1})

N-(1-methylpyrazol-4-yl)acetamide (CAS 1342722-90-0) is a chemical compound with the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. IUPAC name: N-(1-methylpyrazol-4-yl)acetamide. InChIKey: ZCWIYNAPEGGIPX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O
Molecular weight139.16 g/mol
IUPAC nameN-(1-methylpyrazol-4-yl)acetamide
InChIKeyZCWIYNAPEGGIPX-UHFFFAOYSA-N
SMILESCC(=O)NC1=CN(N=C1)C

Computed by PubChem (NCBI)