Products 1342797-58-3
CAS 1342797-58-3 is the registry number for Acoraminol B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S)-1-methoxy-1-(2,4,5-trimethoxyphenyl)propan-2-ol (CAS 1342797-58-3) is a chemical compound with the molecular formula C13H20O5 and a molecular weight of 256.29 g/mol. IUPAC name: (1R,2S)-1-methoxy-1-(2,4,5-trimethoxyphenyl)propan-2-ol. InChIKey: IXNRGYSRFBDZLB-SDBXPKJASA-N.
| Molecular formula | C13H20O5 |
|---|---|
| Molecular weight | 256.29 g/mol |
| IUPAC name | (1R,2S)-1-methoxy-1-(2,4,5-trimethoxyphenyl)propan-2-ol |
| InChIKey | IXNRGYSRFBDZLB-SDBXPKJASA-N |
| SMILES | C[C@@H]([C@@H](C1=CC(=C(C=C1OC)OC)OC)OC)O |
Computed by PubChem (NCBI)