CAS 1342867-76-8 is the registry number for 6-Bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride (CAS 1342867-76-8) is a chemical compound with the molecular formula C10H10BrClO2S and a molecular weight of 309.61 g/mol. IUPAC name: 6-bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride. InChIKey: WDEQWRMNRRDSML-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO2S |
|---|---|
| Molecular weight | 309.61 g/mol |
| IUPAC name | 6-bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride |
| InChIKey | WDEQWRMNRRDSML-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1S(=O)(=O)Cl)C=CC(=C2)Br |
Computed by PubChem (NCBI)