Products 1342867-76-8

CAS 1342867-76-8 is the registry number for 6-Bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride (CAS 1342867-76-8) is a chemical compound with the molecular formula C10H10BrClO2S and a molecular weight of 309.61 g/mol. IUPAC name: 6-bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride. InChIKey: WDEQWRMNRRDSML-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrClO2S
Molecular weight309.61 g/mol
IUPAC name6-bromo-1,2,3,4-tetrahydronaphthalene-2-sulfonyl chloride
InChIKeyWDEQWRMNRRDSML-UHFFFAOYSA-N
SMILESC1CC2=C(CC1S(=O)(=O)Cl)C=CC(=C2)Br

Computed by PubChem (NCBI)